About butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate
butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate (PubChem CID 22160971) has the molecular formula C22H26O6S
and a molecular weight of 418.51 g/mol. Its IUPAC name is butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate.
Molecular Properties
| Compound Name | butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate |
| PubChem CID | 22160971 |
| Molecular Formula | C22H26O6S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate |
| SMILES | CCC(C)OC(=O)c1ccc(O)c(Sc2cc(C(=O)OC(C)CC)ccc2O)c1 |
| InChI | InChI=1S/C22H26O6S/c1-5-13(3)27-21(25)15-7-9-17(23)19(11-15)29-20-12-16(8-10-18(20)24)22(26)28-14(4)6-2/h7-14,23-24H,5-6H2,1-4H3 |
| InChIKey | LKLKSEYWPDZPJW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate?
The IUPAC name of butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate (CID 22160971) is butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate.
What is the SMILES notation for butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate?
The canonical SMILES for butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate is CCC(C)OC(=O)c1ccc(O)c(Sc2cc(C(=O)OC(C)CC)ccc2O)c1.
What is the InChIKey of butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate?
The InChIKey is LKLKSEYWPDZPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O6S/c1-5-13(3)27-21(25)15-7-9-17(23)19(11-15)29-20-12-16(8-10-18(20)24)22(26)28-14(4)6-2/h7-14,23-24H,5-6H2,1-4H3.
What are the key properties of butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate?
butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate has a molecular weight of 418.51 g/mol, XLogP of 5.16, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 3-(5-butan-2-yloxycarbonyl-2-hydroxyphenyl)sulfanyl-4-hydroxybenzoate is sourced from PubChem (CID 22160971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).