C17H29NO2 — CID 22161686
7-heptanoyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one (PubChem CID 22161686) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 7-heptanoyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one.
| Compound Name | 7-heptanoyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 22161686 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 7-heptanoyl-2-methyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
| SMILES | CCCCCCC(=O)C1CC2CN(C)CCC2CC1=O |
| InChI | InChI=1S/C17H29NO2/c1-3-4-5-6-7-16(19)15-10-14-12-18(2)9-8-13(14)11-17(15)20/h13-15H,3-12H2,1-2H3 |
| InChIKey | WKOVXHQGBIMOFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|