About 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate
1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate (PubChem CID 22162520) has the molecular formula C25H34O4
and a molecular weight of 398.54 g/mol. Its IUPAC name is 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate.
Molecular Properties
| Compound Name | 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate |
| PubChem CID | 22162520 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(C)OC(=O)C(C)OC)cc2)cc1 |
| InChI | InChI=1S/C25H34O4/c1-5-6-7-8-9-18-28-24-16-14-23(15-17-24)22-12-10-21(11-13-22)19(2)29-25(26)20(3)27-4/h10-17,19-20H,5-9,18H2,1-4H3 |
| InChIKey | AOWUPXACGKTBFP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate?
The IUPAC name of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate (CID 22162520) is 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate.
What is the SMILES notation for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate?
The canonical SMILES for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate is CCCCCCCOc1ccc(-c2ccc(C(C)OC(=O)C(C)OC)cc2)cc1.
What is the InChIKey of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate?
The InChIKey is AOWUPXACGKTBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O4/c1-5-6-7-8-9-18-28-24-16-14-23(15-17-24)22-12-10-21(11-13-22)19(2)29-25(26)20(3)27-4/h10-17,19-20H,5-9,18H2,1-4H3.
What are the key properties of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate?
1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate has a molecular weight of 398.54 g/mol, XLogP of 6.34, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-methoxypropanoate is sourced from PubChem (CID 22162520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).