About 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate
1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate (PubChem CID 22162436) has the molecular formula C27H38O4
and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate.
Molecular Properties
| Compound Name | 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate |
| PubChem CID | 22162436 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(C(C)OC(=O)C(C)OCCC)cc2)cc1 |
| InChI | InChI=1S/C27H38O4/c1-5-7-8-9-10-20-30-26-17-15-25(16-18-26)24-13-11-23(12-14-24)21(3)31-27(28)22(4)29-19-6-2/h11-18,21-22H,5-10,19-20H2,1-4H3 |
| InChIKey | VGSGCJCVHMGIFP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate?
The IUPAC name of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate (CID 22162436) is 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate.
What is the SMILES notation for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate?
The canonical SMILES for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate is CCCCCCCOc1ccc(-c2ccc(C(C)OC(=O)C(C)OCCC)cc2)cc1.
What is the InChIKey of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate?
The InChIKey is VGSGCJCVHMGIFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O4/c1-5-7-8-9-10-20-30-26-17-15-25(16-18-26)24-13-11-23(12-14-24)21(3)31-27(28)22(4)29-19-6-2/h11-18,21-22H,5-10,19-20H2,1-4H3.
What are the key properties of 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate?
1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate has a molecular weight of 426.60 g/mol, XLogP of 7.12, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-heptoxyphenyl)phenyl]ethyl 2-propoxypropanoate is sourced from PubChem (CID 22162436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).