About 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate
1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate (PubChem CID 22162498) has the molecular formula C30H44O3
and a molecular weight of 452.68 g/mol. Its IUPAC name is 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate.
Molecular Properties
| Compound Name | 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate |
| PubChem CID | 22162498 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(C)OC(=O)C(C)OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H44O3/c1-5-7-9-11-12-14-26-15-17-28(18-16-26)29-21-19-27(20-22-29)24(3)33-30(31)25(4)32-23-13-10-8-6-2/h15-22,24-25H,5-14,23H2,1-4H3 |
| InChIKey | NQUVXWIMQRWUOP-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate?
The IUPAC name of 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate (CID 22162498) is 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate.
What is the SMILES notation for 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate?
The canonical SMILES for 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate is CCCCCCCc1ccc(-c2ccc(C(C)OC(=O)C(C)OCCCCCC)cc2)cc1.
What is the InChIKey of 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate?
The InChIKey is NQUVXWIMQRWUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H44O3/c1-5-7-9-11-12-14-26-15-17-28(18-16-26)29-21-19-27(20-22-29)24(3)33-30(31)25(4)32-23-13-10-8-6-2/h15-22,24-25H,5-14,23H2,1-4H3.
What are the key properties of 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate?
1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate has a molecular weight of 452.68 g/mol, XLogP of 8.46, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-heptylphenyl)phenyl]ethyl 2-hexoxypropanoate is sourced from PubChem (CID 22162498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).