About 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate
1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate (PubChem CID 22162439) has the molecular formula C31H46O3
and a molecular weight of 466.71 g/mol. Its IUPAC name is 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate.
Molecular Properties
| Compound Name | 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate |
| PubChem CID | 22162439 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate |
| SMILES | CCCCCCCCOC(C)C(=O)OC(C)c1ccc(-c2ccc(CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C31H46O3/c1-5-7-9-11-12-14-24-33-26(4)31(32)34-25(3)28-20-22-30(23-21-28)29-18-16-27(17-19-29)15-13-10-8-6-2/h16-23,25-26H,5-15,24H2,1-4H3 |
| InChIKey | DPPRTOCHPSQOSP-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate?
The IUPAC name of 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate (CID 22162439) is 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate.
What is the SMILES notation for 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate?
The canonical SMILES for 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate is CCCCCCCCOC(C)C(=O)OC(C)c1ccc(-c2ccc(CCCCCC)cc2)cc1.
What is the InChIKey of 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate?
The InChIKey is DPPRTOCHPSQOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46O3/c1-5-7-9-11-12-14-24-33-26(4)31(32)34-25(3)28-20-22-30(23-21-28)29-18-16-27(17-19-29)15-13-10-8-6-2/h16-23,25-26H,5-15,24H2,1-4H3.
What are the key properties of 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate?
1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate has a molecular weight of 466.71 g/mol, XLogP of 8.85, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-hexylphenyl)phenyl]ethyl 2-octoxypropanoate is sourced from PubChem (CID 22162439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).