C13H14ClNO — CID 22163961
1-[(2-chlorophenyl)methyl]-5-ethenylpyrrolidin-2-one (PubChem CID 22163961) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-5-ethenylpyrrolidin-2-one.
| Compound Name | 1-[(2-chlorophenyl)methyl]-5-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 22163961 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-5-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CCC(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C13H14ClNO/c1-2-11-7-8-13(16)15(11)9-10-5-3-4-6-12(10)14/h2-6,11H,1,7-9H2 |
| InChIKey | HDMQKMSZJJTAHK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|