About dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate
dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate (PubChem CID 22165305) has the molecular formula C18H33NO5S2
and a molecular weight of 407.60 g/mol. Its IUPAC name is dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate.
Molecular Properties
| Compound Name | dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate |
| PubChem CID | 22165305 |
| Molecular Formula | C18H33NO5S2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate |
| SMILES | CCCCCOC(=O)CC(C(=O)OCCCCC)C(=S)N(S)CCOC |
| InChI | InChI=1S/C18H33NO5S2/c1-4-6-8-11-23-16(20)14-15(17(25)19(26)10-13-22-3)18(21)24-12-9-7-5-2/h15,26H,4-14H2,1-3H3 |
| InChIKey | HFJCKPGTFBLZNM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate?
The IUPAC name of dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate (CID 22165305) is dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate.
What is the SMILES notation for dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate?
The canonical SMILES for dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate is CCCCCOC(=O)CC(C(=O)OCCCCC)C(=S)N(S)CCOC.
What is the InChIKey of dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate?
The InChIKey is HFJCKPGTFBLZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO5S2/c1-4-6-8-11-23-16(20)14-15(17(25)19(26)10-13-22-3)18(21)24-12-9-7-5-2/h15,26H,4-14H2,1-3H3.
What are the key properties of dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate?
dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate has a molecular weight of 407.60 g/mol, XLogP of 3.58, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipentyl 2-[2-methoxyethyl(sulfanyl)carbamothioyl]butanedioate is sourced from PubChem (CID 22165305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).