About cyclohexyl phosphite;ethene
cyclohexyl phosphite;ethene (PubChem CID 22165796) has the molecular formula C8H15O3P-2
and a molecular weight of 190.18 g/mol. Its IUPAC name is cyclohexyl phosphite;ethene.
Molecular Properties
| Compound Name | cyclohexyl phosphite;ethene |
| PubChem CID | 22165796 |
| Molecular Formula | C8H15O3P-2 |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | cyclohexyl phosphite;ethene |
| SMILES | C=C.[O-]P([O-])OC1CCCCC1 |
| InChI | InChI=1S/C6H11O3P.C2H4/c7-10(8)9-6-4-2-1-3-5-6;1-2/h6H,1-5H2;1-2H2/q-2; |
| InChIKey | AMYYNSYHZZZCCC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl phosphite;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl phosphite;ethene?
The IUPAC name of cyclohexyl phosphite;ethene (CID 22165796) is cyclohexyl phosphite;ethene.
What is the SMILES notation for cyclohexyl phosphite;ethene?
The canonical SMILES for cyclohexyl phosphite;ethene is C=C.[O-]P([O-])OC1CCCCC1.
What is the InChIKey of cyclohexyl phosphite;ethene?
The InChIKey is AMYYNSYHZZZCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O3P.C2H4/c7-10(8)9-6-4-2-1-3-5-6;1-2/h6H,1-5H2;1-2H2/q-2;.
What are the key properties of cyclohexyl phosphite;ethene?
cyclohexyl phosphite;ethene has a molecular weight of 190.18 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl phosphite;ethene is sourced from PubChem (CID 22165796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).