About benzene;tricyclohexyl phosphite
benzene;tricyclohexyl phosphite (PubChem CID 70561522) has the molecular formula C24H39O3P
and a molecular weight of 406.55 g/mol. Its IUPAC name is benzene;tricyclohexyl phosphite.
Molecular Properties
| Compound Name | benzene;tricyclohexyl phosphite |
| PubChem CID | 70561522 |
| Molecular Formula | C24H39O3P |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | benzene;tricyclohexyl phosphite |
| SMILES | C1CCC(OP(OC2CCCCC2)OC2CCCCC2)CC1.c1ccccc1 |
| InChI | InChI=1S/C18H33O3P.C6H6/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;1-2-4-6-5-3-1/h16-18H,1-15H2;1-6H |
| InChIKey | ZGXBLUTZGFJCRK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;tricyclohexyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;tricyclohexyl phosphite?
The IUPAC name of benzene;tricyclohexyl phosphite (CID 70561522) is benzene;tricyclohexyl phosphite.
What is the SMILES notation for benzene;tricyclohexyl phosphite?
The canonical SMILES for benzene;tricyclohexyl phosphite is C1CCC(OP(OC2CCCCC2)OC2CCCCC2)CC1.c1ccccc1.
What is the InChIKey of benzene;tricyclohexyl phosphite?
The InChIKey is ZGXBLUTZGFJCRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33O3P.C6H6/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;1-2-4-6-5-3-1/h16-18H,1-15H2;1-6H.
What are the key properties of benzene;tricyclohexyl phosphite?
benzene;tricyclohexyl phosphite has a molecular weight of 406.55 g/mol, XLogP of 7.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;tricyclohexyl phosphite is sourced from PubChem (CID 70561522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).