About N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide
N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide (PubChem CID 22165806) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide |
| PubChem CID | 22165806 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide |
| SMILES | CCOc1ccc(C(C)(C)C)cc1NC(=O)C(=O)N(CC)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3/c1-6-24(17-11-9-8-10-12-17)21(26)20(25)23-18-15-16(22(3,4)5)13-14-19(18)27-7-2/h8-15H,6-7H2,1-5H3,(H,23,25) |
| InChIKey | FRMGGJVUGOGJHL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide?
The IUPAC name of N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide (CID 22165806) is N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide.
What is the SMILES notation for N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide?
The canonical SMILES for N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide is CCOc1ccc(C(C)(C)C)cc1NC(=O)C(=O)N(CC)c1ccccc1.
What is the InChIKey of N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide?
The InChIKey is FRMGGJVUGOGJHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-6-24(17-11-9-8-10-12-17)21(26)20(25)23-18-15-16(22(3,4)5)13-14-19(18)27-7-2/h8-15H,6-7H2,1-5H3,(H,23,25).
What are the key properties of N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide?
N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide has a molecular weight of 368.48 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-tert-butyl-2-ethoxyphenyl)-N'-ethyl-N'-phenyloxamide is sourced from PubChem (CID 22165806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).