C12H12FN3O3 — CID 22167843
6-(4-fluoro-3-nitrophenyl)-2,5-dimethyl-4,5-dihydropyridazin-3-one (PubChem CID 22167843) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 6-(4-fluoro-3-nitrophenyl)-2,5-dimethyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(4-fluoro-3-nitrophenyl)-2,5-dimethyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 22167843 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6-(4-fluoro-3-nitrophenyl)-2,5-dimethyl-4,5-dihydropyridazin-3-one |
| SMILES | CC1CC(=O)N(C)N=C1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12FN3O3/c1-7-5-11(17)15(2)14-12(7)8-3-4-9(13)10(6-8)16(18)19/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | AARKJUUTZUYRKM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|