C12H5Cl3FNO2 — CID 134628234
1,2,3-trichloro-5-(4-fluoro-3-nitrophenyl)benzene (PubChem CID 134628234) has the molecular formula C12H5Cl3FNO2 and a molecular weight of 320.53 g/mol. Its IUPAC name is 1,2,3-trichloro-5-(4-fluoro-3-nitrophenyl)benzene.
| Compound Name | 1,2,3-trichloro-5-(4-fluoro-3-nitrophenyl)benzene |
|---|---|
| PubChem CID | 134628234 |
| Molecular Formula | C12H5Cl3FNO2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 1,2,3-trichloro-5-(4-fluoro-3-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1cc(-c2cc(Cl)c(Cl)c(Cl)c2)ccc1F |
| InChI | InChI=1S/C12H5Cl3FNO2/c13-8-3-7(4-9(14)12(8)15)6-1-2-10(16)11(5-6)17(18)19/h1-5H |
| InChIKey | HNDXUDCIEOILKI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|