C18H21F3N2O2S — CID 2216847
ethyl 4-[[(6R)-3-cyano-6-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]butanoate (PubChem CID 2216847) has the molecular formula C18H21F3N2O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is ethyl 4-[[(6R)-3-cyano-6-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]butanoate.
| Compound Name | ethyl 4-[[(6R)-3-cyano-6-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 2216847 |
| Molecular Formula | C18H21F3N2O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 4-[[(6R)-3-cyano-6-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1nc2c(c(C(F)(F)F)c1C#N)C[C@H](C)CC2 |
| InChI | InChI=1S/C18H21F3N2O2S/c1-3-25-15(24)5-4-8-26-17-13(10-22)16(18(19,20)21)12-9-11(2)6-7-14(12)23-17/h11H,3-9H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZAZMPEZUEMKGHN-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|