C10H17N3OS — CID 22170819
N-[5-(diethylaminomethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 22170819) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[5-(diethylaminomethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(diethylaminomethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 22170819 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[5-(diethylaminomethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(CC)Cc1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-13(5-2)7-9-6-11-10(15-9)12-8(3)14/h6H,4-5,7H2,1-3H3,(H,11,12,14) |
| InChIKey | RSNKRYQOXWXBRO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |