C9H15NO — CID 22171759
1-ethenyl-3,5-dimethylpiperidin-2-one (PubChem CID 22171759) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-ethenyl-3,5-dimethylpiperidin-2-one.
| Compound Name | 1-ethenyl-3,5-dimethylpiperidin-2-one |
|---|---|
| PubChem CID | 22171759 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-ethenyl-3,5-dimethylpiperidin-2-one |
| SMILES | C=CN1CC(C)CC(C)C1=O |
| InChI | InChI=1S/C9H15NO/c1-4-10-6-7(2)5-8(3)9(10)11/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | ZOZQTPQWSYVFPY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |