C29H34FN5O3 — CID 22174844
N-cyclopentyl-4-[2-(4-fluorophenyl)-6-(triethoxymethyl)pyrazolo[1,5-a]pyridin-3-yl]pyrimidin-2-amine (PubChem CID 22174844) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is N-cyclopentyl-4-[2-(4-fluorophenyl)-6-(triethoxymethyl)pyrazolo[1,5-a]pyridin-3-yl]pyrimidin-2-amine.
| Compound Name | N-cyclopentyl-4-[2-(4-fluorophenyl)-6-(triethoxymethyl)pyrazolo[1,5-a]pyridin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 22174844 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | N-cyclopentyl-4-[2-(4-fluorophenyl)-6-(triethoxymethyl)pyrazolo[1,5-a]pyridin-3-yl]pyrimidin-2-amine |
| SMILES | CCOC(OCC)(OCC)c1ccc2c(-c3ccnc(NC4CCCC4)n3)c(-c3ccc(F)cc3)nn2c1 |
| InChI | InChI=1S/C29H34FN5O3/c1-4-36-29(37-5-2,38-6-3)21-13-16-25-26(24-17-18-31-28(33-24)32-23-9-7-8-10-23)27(34-35(25)19-21)20-11-14-22(30)15-12-20/h11-19,23H,4-10H2,1-3H3,(H,31,32,33) |
| InChIKey | HJXDOHUYWQPBAV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|