C19H26FNO3 — CID 22175702
4-butoxy-2-(2,2-dimethylpropyl)-7-fluoro-3-(hydroxymethyl)isoquinolin-1-one (PubChem CID 22175702) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-butoxy-2-(2,2-dimethylpropyl)-7-fluoro-3-(hydroxymethyl)isoquinolin-1-one.
| Compound Name | 4-butoxy-2-(2,2-dimethylpropyl)-7-fluoro-3-(hydroxymethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 22175702 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-butoxy-2-(2,2-dimethylpropyl)-7-fluoro-3-(hydroxymethyl)isoquinolin-1-one |
| SMILES | CCCCOc1c(CO)n(CC(C)(C)C)c(=O)c2cc(F)ccc12 |
| InChI | InChI=1S/C19H26FNO3/c1-5-6-9-24-17-14-8-7-13(20)10-15(14)18(23)21(16(17)11-22)12-19(2,3)4/h7-8,10,22H,5-6,9,11-12H2,1-4H3 |
| InChIKey | RJUIFELSJLMHGM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|