C22H26Cl2N4O — CID 22177836
10-(2,5-dichloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 22177836) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 10-(2,5-dichloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(2,5-dichloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 22177836 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 10-(2,5-dichloro-4-methoxyphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4cc(Cl)c(OC)cc4Cl)c(C)nn13)CCC2 |
| InChI | InChI=1S/C22H26Cl2N4O/c1-5-13(6-2)25-21-14-8-7-9-18(14)26-22-20(12(3)27-28(21)22)15-10-17(24)19(29-4)11-16(15)23/h10-11,13,25H,5-9H2,1-4H3 |
| InChIKey | ZDVRDURICDTJDL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |