3-(ethylamino)propanamide;prop-2-enoic acid

C8H16N2O3 — CID 22182171

IUPAC3-(ethylamino)propanamide;prop-2-enoic acid
SMILESC=CC(=O)O.CCNCCC(N)=O
InChIInChI=1S/C5H12N2O.C3H4O2/c1-2-7-4-3-5(6)8;1-2-3(4)5/h7H,2-4H2,1H3,(H2,6,8);2H,1H2,(H,4,5)
InChIKeyXNALYQPXIMYGEE-UHFFFAOYSA-N
MW188.23 g/mol
LogP-0.27
Rot. Bonds5

About 3-(ethylamino)propanamide;prop-2-enoic acid

3-(ethylamino)propanamide;prop-2-enoic acid (PubChem CID 22182171) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-(ethylamino)propanamide;prop-2-enoic acid.

Molecular Properties

Compound Name3-(ethylamino)propanamide;prop-2-enoic acid
PubChem CID22182171
Molecular FormulaC8H16N2O3
Molecular Weight188.23 g/mol
Exact Mass188.12
IUPAC Name3-(ethylamino)propanamide;prop-2-enoic acid
SMILESC=CC(=O)O.CCNCCC(N)=O
InChIInChI=1S/C5H12N2O.C3H4O2/c1-2-7-4-3-5(6)8;1-2-3(4)5/h7H,2-4H2,1H3,(H2,6,8);2H,1H2,(H,4,5)
InChIKeyXNALYQPXIMYGEE-UHFFFAOYSA-N
XLogP-0.27
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.23
LogP ≤ 5-0.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(ethylamino)propanamide;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(ethylamino)propanamide;prop-2-enoic acid?
The IUPAC name of 3-(ethylamino)propanamide;prop-2-enoic acid (CID 22182171) is 3-(ethylamino)propanamide;prop-2-enoic acid.
What is the SMILES notation for 3-(ethylamino)propanamide;prop-2-enoic acid?
The canonical SMILES for 3-(ethylamino)propanamide;prop-2-enoic acid is C=CC(=O)O.CCNCCC(N)=O.
What is the InChIKey of 3-(ethylamino)propanamide;prop-2-enoic acid?
The InChIKey is XNALYQPXIMYGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.C3H4O2/c1-2-7-4-3-5(6)8;1-2-3(4)5/h7H,2-4H2,1H3,(H2,6,8);2H,1H2,(H,4,5).
What are the key properties of 3-(ethylamino)propanamide;prop-2-enoic acid?
3-(ethylamino)propanamide;prop-2-enoic acid has a molecular weight of 188.23 g/mol, XLogP of -0.27, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)propanamide;prop-2-enoic acid is sourced from PubChem (CID 22182171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).