C8H16N2O3 — CID 22182171
3-(ethylamino)propanamide;prop-2-enoic acid (PubChem CID 22182171) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-(ethylamino)propanamide;prop-2-enoic acid.
| Compound Name | 3-(ethylamino)propanamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 22182171 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-(ethylamino)propanamide;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCNCCC(N)=O |
| InChI | InChI=1S/C5H12N2O.C3H4O2/c1-2-7-4-3-5(6)8;1-2-3(4)5/h7H,2-4H2,1H3,(H2,6,8);2H,1H2,(H,4,5) |
| InChIKey | XNALYQPXIMYGEE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|