C13H22N4 — CID 22184577
2-N-[2-(4-methylpiperazin-1-yl)ethyl]benzene-1,2-diamine (PubChem CID 22184577) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-N-[2-(4-methylpiperazin-1-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-(4-methylpiperazin-1-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 22184577 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-N-[2-(4-methylpiperazin-1-yl)ethyl]benzene-1,2-diamine |
| SMILES | CN1CCN(CCNc2ccccc2N)CC1 |
| InChI | InChI=1S/C13H22N4/c1-16-8-10-17(11-9-16)7-6-15-13-5-3-2-4-12(13)14/h2-5,15H,6-11,14H2,1H3 |
| InChIKey | LSJRZEDIWKISPP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|