C20H23N3O5 — CID 22184957
ethyl 4-[3-[(5-hydroxynaphthalen-2-yl)amino]-3-oxopropanoyl]piperazine-1-carboxylate (PubChem CID 22184957) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 4-[3-[(5-hydroxynaphthalen-2-yl)amino]-3-oxopropanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[(5-hydroxynaphthalen-2-yl)amino]-3-oxopropanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22184957 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 4-[3-[(5-hydroxynaphthalen-2-yl)amino]-3-oxopropanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CC(=O)Nc2ccc3c(O)cccc3c2)CC1 |
| InChI | InChI=1S/C20H23N3O5/c1-2-28-20(27)23-10-8-22(9-11-23)19(26)13-18(25)21-15-6-7-16-14(12-15)4-3-5-17(16)24/h3-7,12,24H,2,8-11,13H2,1H3,(H,21,25) |
| InChIKey | JIWSENQFKHQQBA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|