C47H74O11 — CID 22185965
[(4Z)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate (PubChem CID 22185965) has the molecular formula C47H74O11 and a molecular weight of 815.10 g/mol. Its IUPAC name is [(4Z)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate.
| Compound Name | [(4Z)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate |
|---|---|
| PubChem CID | 22185965 |
| Molecular Formula | C47H74O11 |
| Molecular Weight | 815.10 g/mol |
| Exact Mass | 814.52 |
| IUPAC Name | [(4Z)-7,10-bis(1-ethoxyethoxy)-2-[(2E,4E)-7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] benzoate |
| SMILES | CCOC(C)OC1CCC(C)(OC(C)OCC)C(OC(=O)c2ccccc2)/C=C\C(C)C(/C(C)=C/C=C/C(C)CC2OC2C(C)C(CC)OC(C)OCC)OC(=O)C1 |
| InChI | InChI=1S/C47H74O11/c1-13-40(54-36(10)51-15-3)34(8)45-41(55-45)29-31(5)21-20-22-32(6)44-33(7)25-26-42(56-46(49)38-23-18-17-19-24-38)47(12,58-37(11)52-16-4)28-27-39(30-43(48)57-44)53-35(9)50-14-2/h17-26,31,33-37,39-42,44-45H,13-16,27-30H2,1-12H3/b21-20+,26-25-,32-22+ |
| InChIKey | PEAUFOWHRSFQRW-OBWPVIFISA-N |
| XLogP | 9.54 |
| TPSA | 120.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.10 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|