C36H54O11 — CID 58619133
[(9E)-7,8-diacetyloxy-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate (PubChem CID 58619133) has the molecular formula C36H54O11 and a molecular weight of 662.82 g/mol. Its IUPAC name is [(9E)-7,8-diacetyloxy-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate.
| Compound Name | [(9E)-7,8-diacetyloxy-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate |
|---|---|
| PubChem CID | 58619133 |
| Molecular Formula | C36H54O11 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | [(9E)-7,8-diacetyloxy-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate |
| SMILES | CCC(OC(C)=O)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(OC(C)=O)CCC(C)(OC(C)=O)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C36H54O11/c1-11-30(43-26(7)38)24(5)35-31(45-35)19-21(2)13-12-14-22(3)34-23(4)15-16-32(44-27(8)39)36(10,47-28(9)40)18-17-29(42-25(6)37)20-33(41)46-34/h12-16,21,23-24,29-32,34-35H,11,17-20H2,1-10H3/b13-12+,16-15+,22-14+ |
| InChIKey | PAPJMIZAOOAVBZ-KHLUFOHVSA-N |
| XLogP | 5.73 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|