C32H48O8 — CID 76840112
[2-[7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododeca-4,10-dien-6-yl] acetate (PubChem CID 76840112) has the molecular formula C32H48O8 and a molecular weight of 560.73 g/mol. Its IUPAC name is [2-[7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododeca-4,10-dien-6-yl] acetate.
| Compound Name | [2-[7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododeca-4,10-dien-6-yl] acetate |
|---|---|
| PubChem CID | 76840112 |
| Molecular Formula | C32H48O8 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | [2-[7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododeca-4,10-dien-6-yl] acetate |
| SMILES | CCC(OC(C)=O)C(C)C1OC1CC(C)C=CC=C(C)C1OC(=O)C=CCCC(C)(O)C(OC(C)=O)C=CC1C |
| InChI | InChI=1S/C32H48O8/c1-9-26(37-24(6)33)23(5)31-27(39-31)19-20(2)13-12-14-21(3)30-22(4)16-17-28(38-25(7)34)32(8,36)18-11-10-15-29(35)40-30/h10,12-17,20,22-23,26-28,30-31,36H,9,11,18-19H2,1-8H3 |
| InChIKey | PXVSMOXOXKKMOT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|