C34H53ClO10 — CID 22186028
[(4Z)-2-[(2E,4E)-8,11-diacetyloxy-9-chloro-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 22186028) has the molecular formula C34H53ClO10 and a molecular weight of 657.24 g/mol. Its IUPAC name is [(4Z)-2-[(2E,4E)-8,11-diacetyloxy-9-chloro-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4Z)-2-[(2E,4E)-8,11-diacetyloxy-9-chloro-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 22186028 |
| Molecular Formula | C34H53ClO10 |
| Molecular Weight | 657.24 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | [(4Z)-2-[(2E,4E)-8,11-diacetyloxy-9-chloro-6,10-dimethyltrideca-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(OC(C)=O)C(C)C(Cl)C(CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(C)=O)/C=C\C1C)OC(C)=O |
| InChI | InChI=1S/C34H53ClO10/c1-10-28(42-24(6)36)23(5)32(35)29(43-25(7)37)18-20(2)12-11-13-21(3)33-22(4)14-15-30(44-26(8)38)34(9,41)17-16-27(39)19-31(40)45-33/h11-15,20,22-23,27-30,32-33,39,41H,10,16-19H2,1-9H3/b12-11+,15-14-,21-13+ |
| InChIKey | DQHMSQFGJJPAAN-BABBNWDVSA-N |
| XLogP | 5.36 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|