C24H37NO8 — CID 155783657
[(2S,3S,4Z,6S,7S,10S)-2-[(2E,4E,6R)-7-carbamoyloxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 155783657) has the molecular formula C24H37NO8 and a molecular weight of 467.56 g/mol. Its IUPAC name is [(2S,3S,4Z,6S,7S,10S)-2-[(2E,4E,6R)-7-carbamoyloxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4Z,6S,7S,10S)-2-[(2E,4E,6R)-7-carbamoyloxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 155783657 |
| Molecular Formula | C24H37NO8 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | [(2S,3S,4Z,6S,7S,10S)-2-[(2E,4E,6R)-7-carbamoyloxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C\[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)COC(N)=O)OC(=O)C[C@@H](O)CC[C@]1(C)O |
| InChI | InChI=1S/C24H37NO8/c1-15(14-31-23(25)29)7-6-8-16(2)22-17(3)9-10-20(32-18(4)26)24(5,30)12-11-19(27)13-21(28)33-22/h6-10,15,17,19-20,22,27,30H,11-14H2,1-5H3,(H2,25,29)/b7-6+,10-9-,16-8+/t15-,17+,19+,20+,22-,24+/m1/s1 |
| InChIKey | VGZJUZOSIDNSLD-KOLIGYCJSA-N |
| XLogP | 2.55 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|