C29H45NO8 — CID 159338698
[(2R,3E,5E)-6-[(2S,3S,4E,6S,7R,10R)-6-acetyloxy-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] (3S)-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 159338698) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is [(2R,3E,5E)-6-[(2S,3S,4E,6S,7R,10R)-6-acetyloxy-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] (3S)-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | [(2R,3E,5E)-6-[(2S,3S,4E,6S,7R,10R)-6-acetyloxy-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] (3S)-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159338698 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [(2R,3E,5E)-6-[(2S,3S,4E,6S,7R,10R)-6-acetyloxy-7-hydroxy-3,7,10-trimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] (3S)-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)COC(=O)N2CC[C@H](O)C2)OC(=O)C[C@H](C)CC[C@@]1(C)O |
| InChI | InChI=1S/C29H45NO8/c1-19-12-14-29(6,35)25(37-23(5)31)11-10-22(4)27(38-26(33)16-19)21(3)9-7-8-20(2)18-36-28(34)30-15-13-24(32)17-30/h7-11,19-20,22,24-25,27,32,35H,12-18H2,1-6H3/b8-7+,11-10+,21-9+/t19-,20-,22+,24+,25+,27-,29-/m1/s1 |
| InChIKey | KMLYEOXVLZJPAN-IYYXNOENSA-N |
| XLogP | 3.93 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|