C27H41NO8S — CID 177306001
[(2R,3E,5E)-6-[(2S,3S,4Z,6S,7R,10R)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] 1,3-thiazolidine-3-carboxylate (PubChem CID 177306001) has the molecular formula C27H41NO8S and a molecular weight of 539.69 g/mol. Its IUPAC name is [(2R,3E,5E)-6-[(2S,3S,4Z,6S,7R,10R)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] 1,3-thiazolidine-3-carboxylate.
| Compound Name | [(2R,3E,5E)-6-[(2S,3S,4Z,6S,7R,10R)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] 1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 177306001 |
| Molecular Formula | C27H41NO8S |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | [(2R,3E,5E)-6-[(2S,3S,4Z,6S,7R,10R)-6-acetyloxy-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] 1,3-thiazolidine-3-carboxylate |
| SMILES | CC(=O)O[C@H]1/C=C\[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)COC(=O)N2CCSC2)OC(=O)C[C@H](O)CC[C@@]1(C)O |
| InChI | InChI=1S/C27H41NO8S/c1-18(16-34-26(32)28-13-14-37-17-28)7-6-8-19(2)25-20(3)9-10-23(35-21(4)29)27(5,33)12-11-22(30)15-24(31)36-25/h6-10,18,20,22-23,25,30,33H,11-17H2,1-5H3/b7-6+,10-9-,19-8+/t18-,20+,22-,23+,25-,27-/m1/s1 |
| InChIKey | KKRCXIHXMAZOSQ-XDOCZLQVSA-N |
| XLogP | 3.60 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|