C30H50O9 — CID 21024102
[(4Z)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-8,9,11-trihydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 21024102) has the molecular formula C30H50O9 and a molecular weight of 554.72 g/mol. Its IUPAC name is [(4Z)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-8,9,11-trihydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4Z)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-8,9,11-trihydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 21024102 |
| Molecular Formula | C30H50O9 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | [(4Z)-7,10-dihydroxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-8,9,11-trihydroxy-6,10-dimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(O)C(C)C(O)C(O)CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(C)=O)/C=C\C1C |
| InChI | InChI=1S/C30H50O9/c1-8-24(33)21(5)28(36)25(34)16-18(2)10-9-11-19(3)29-20(4)12-13-26(38-22(6)31)30(7,37)15-14-23(32)17-27(35)39-29/h9-13,18,20-21,23-26,28-29,32-34,36-37H,8,14-17H2,1-7H3/b10-9+,13-12-,19-11+ |
| InChIKey | HUPCIUXTJUNFIN-OUEVBENVSA-N |
| XLogP | 2.98 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|