C32H50O10 — CID 118075297
[(9E)-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-7,8-dihydroxy-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate (PubChem CID 118075297) has the molecular formula C32H50O10 and a molecular weight of 594.74 g/mol. Its IUPAC name is [(9E)-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-7,8-dihydroxy-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate.
| Compound Name | [(9E)-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-7,8-dihydroxy-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate |
|---|---|
| PubChem CID | 118075297 |
| Molecular Formula | C32H50O10 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | [(9E)-12-[(2E,4E)-7-[3-(3-acetyloxypentan-2-yl)oxiran-2-yl]-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-7,8-dihydroxy-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] acetate |
| SMILES | CCC(OC(C)=O)C(C)C1OC1CC(C)(O)/C=C/C=C(\C)C1OC(=O)CC(OC(C)=O)CCC(C)(O)C(O)/C=C/C1C |
| InChI | InChI=1S/C32H50O10/c1-9-25(40-23(6)34)21(4)30-26(41-30)18-31(7,37)15-10-11-19(2)29-20(3)12-13-27(35)32(8,38)16-14-24(39-22(5)33)17-28(36)42-29/h10-13,15,20-21,24-27,29-30,35,37-38H,9,14,16-18H2,1-8H3/b13-12+,15-10+,19-11+ |
| InChIKey | HLWHVHBRXPJCIO-LIXUXYNVSA-N |
| XLogP | 3.71 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|