C32H53NO8S — CID 91358944
O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-propan-2-ylcarbamothioate (PubChem CID 91358944) has the molecular formula C32H53NO8S and a molecular weight of 611.84 g/mol. Its IUPAC name is O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-propan-2-ylcarbamothioate.
| Compound Name | O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-propan-2-ylcarbamothioate |
|---|---|
| PubChem CID | 91358944 |
| Molecular Formula | C32H53NO8S |
| Molecular Weight | 611.84 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-propan-2-ylcarbamothioate |
| SMILES | CCC(O)C(C)C1OC1CC(C)(O)C=CC=C(C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=S)NC(C)C)C=CC1C |
| InChI | InChI=1S/C32H53NO8S/c1-9-24(35)22(6)29-25(39-29)18-31(7,37)15-10-11-20(4)28-21(5)12-13-26(40-30(42)33-19(2)3)32(8,38)16-14-23(34)17-27(36)41-28/h10-13,15,19,21-26,28-29,34-35,37-38H,9,14,16-18H2,1-8H3,(H,33,42) |
| InChIKey | YLGKXTRJUDONDD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|