C33H55NO8S — CID 74015185
O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-butylcarbamothioate (PubChem CID 74015185) has the molecular formula C33H55NO8S and a molecular weight of 625.87 g/mol. Its IUPAC name is O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-butylcarbamothioate.
| Compound Name | O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-butylcarbamothioate |
|---|---|
| PubChem CID | 74015185 |
| Molecular Formula | C33H55NO8S |
| Molecular Weight | 625.87 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | O-[[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]] N-butylcarbamothioate |
| SMILES | CCCCNC(=S)OC1C=CC(C)C(C(C)=CC=CC(C)(O)CC2OC2C(C)C(O)CC)OC(=O)CC(O)CCC1(C)O |
| InChI | InChI=1S/C33H55NO8S/c1-8-10-18-34-31(43)41-27-14-13-22(4)29(42-28(37)19-24(35)15-17-33(27,7)39)21(3)12-11-16-32(6,38)20-26-30(40-26)23(5)25(36)9-2/h11-14,16,22-27,29-30,35-36,38-39H,8-10,15,17-20H2,1-7H3,(H,34,43) |
| InChIKey | AILJPWARBYTMEY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|