C36H60N2O10 — CID 91157566
[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(3-morpholin-4-ylpropyl)carbamate (PubChem CID 91157566) has the molecular formula C36H60N2O10 and a molecular weight of 680.88 g/mol. Its IUPAC name is [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(3-morpholin-4-ylpropyl)carbamate.
| Compound Name | [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(3-morpholin-4-ylpropyl)carbamate |
|---|---|
| PubChem CID | 91157566 |
| Molecular Formula | C36H60N2O10 |
| Molecular Weight | 680.88 g/mol |
| Exact Mass | 680.42 |
| IUPAC Name | [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] N-(3-morpholin-4-ylpropyl)carbamate |
| SMILES | CCC(O)C(C)C1OC1CC(C)(O)C=CC=C(C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)NCCCN2CCOCC2)C=CC1C |
| InChI | InChI=1S/C36H60N2O10/c1-7-28(40)26(4)33-29(46-33)23-35(5,43)14-8-10-24(2)32-25(3)11-12-30(36(6,44)15-13-27(39)22-31(41)48-32)47-34(42)37-16-9-17-38-18-20-45-21-19-38/h8,10-12,14,25-30,32-33,39-40,43-44H,7,9,13,15-23H2,1-6H3,(H,37,42) |
| InChIKey | QSIGQAAGFOWZOX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|