C38H64N2O9 — CID 85117995
[7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-butyl-1,4-diazepane-1-carboxylate (PubChem CID 85117995) has the molecular formula C38H64N2O9 and a molecular weight of 692.93 g/mol. Its IUPAC name is [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-butyl-1,4-diazepane-1-carboxylate.
| Compound Name | [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-butyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 85117995 |
| Molecular Formula | C38H64N2O9 |
| Molecular Weight | 692.93 g/mol |
| Exact Mass | 692.46 |
| IUPAC Name | [7,10-dihydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-butyl-1,4-diazepane-1-carboxylate |
| SMILES | CCCCN1CCCN(C(=O)OC2C=CC(C)C(C(C)=CC=CC(C)(O)CC3OC3C(C)C(O)CC)OC(=O)CC(O)CCC2(C)O)CC1 |
| InChI | InChI=1S/C38H64N2O9/c1-8-10-19-39-20-12-21-40(23-22-39)36(44)48-32-15-14-27(4)34(49-33(43)24-29(41)16-18-38(32,7)46)26(3)13-11-17-37(6,45)25-31-35(47-31)28(5)30(42)9-2/h11,13-15,17,27-32,34-35,41-42,45-46H,8-10,12,16,18-25H2,1-7H3 |
| InChIKey | HMGOWKYBTYHYBC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.93 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|