C35H58N2O9 — CID 23069878
[(4Z)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethylpiperazine-1-carboxylate (PubChem CID 23069878) has the molecular formula C35H58N2O9 and a molecular weight of 650.85 g/mol. Its IUPAC name is [(4Z)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethylpiperazine-1-carboxylate.
| Compound Name | [(4Z)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 23069878 |
| Molecular Formula | C35H58N2O9 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | [(4Z)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethylpiperazine-1-carboxylate |
| SMILES | CCC(O)C(C)C1OC1CC(C)(O)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(O)C(OC(=O)N2CCN(CC)CC2)/C=C\C1C |
| InChI | InChI=1S/C35H58N2O9/c1-8-27(39)25(5)32-28(44-32)22-34(6,42)15-10-11-23(3)31-24(4)12-13-29(35(7,43)16-14-26(38)21-30(40)46-31)45-33(41)37-19-17-36(9-2)18-20-37/h10-13,15,24-29,31-32,38-39,42-43H,8-9,14,16-22H2,1-7H3/b13-12-,15-10+,23-11+ |
| InChIKey | DSZNBNHZIUSYBI-COFHXPDVSA-N |
| XLogP | 3.35 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|