C38H62N2O10 — CID 91267173
[6-acetyloxy-10-hydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-7-yl] 4-ethyl-1,4-diazepane-1-carboxylate (PubChem CID 91267173) has the molecular formula C38H62N2O10 and a molecular weight of 706.92 g/mol. Its IUPAC name is [6-acetyloxy-10-hydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-7-yl] 4-ethyl-1,4-diazepane-1-carboxylate.
| Compound Name | [6-acetyloxy-10-hydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-7-yl] 4-ethyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 91267173 |
| Molecular Formula | C38H62N2O10 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.44 |
| IUPAC Name | [6-acetyloxy-10-hydroxy-2-[6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-7-yl] 4-ethyl-1,4-diazepane-1-carboxylate |
| SMILES | CCC(O)C(C)C1OC1CC(C)(O)C=CC=C(C)C1OC(=O)CC(O)CCC(C)(OC(=O)N2CCCN(CC)CC2)C(OC(C)=O)C=CC1C |
| InChI | InChI=1S/C38H62N2O10/c1-9-30(43)27(5)35-31(48-35)24-37(7,46)17-11-13-25(3)34-26(4)14-15-32(47-28(6)41)38(8,18-16-29(42)23-33(44)49-34)50-36(45)40-20-12-19-39(10-2)21-22-40/h11,13-15,17,26-27,29-32,34-35,42-43,46H,9-10,12,16,18-24H2,1-8H3 |
| InChIKey | DAMAJDJBMRQZBA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 158.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|