C36H60N2O8 — CID 23078982
[(4Z)-10-hydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethyl-1,4-diazepane-1-carboxylate (PubChem CID 23078982) has the molecular formula C36H60N2O8 and a molecular weight of 648.88 g/mol. Its IUPAC name is [(4Z)-10-hydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethyl-1,4-diazepane-1-carboxylate.
| Compound Name | [(4Z)-10-hydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 23078982 |
| Molecular Formula | C36H60N2O8 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.43 |
| IUPAC Name | [(4Z)-10-hydroxy-2-[(2E,4E)-6-hydroxy-7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] 4-ethyl-1,4-diazepane-1-carboxylate |
| SMILES | CCC(O)C(C)C1OC1CC(C)(O)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)C(OC(=O)N2CCCN(CC)CC2)/C=C\C1C |
| InChI | InChI=1S/C36H60N2O8/c1-8-29(40)27(6)34-31(44-34)23-36(7,43)17-10-12-25(4)33-26(5)14-16-30(24(3)13-15-28(39)22-32(41)46-33)45-35(42)38-19-11-18-37(9-2)20-21-38/h10,12,14,16-17,24,26-31,33-34,39-40,43H,8-9,11,13,15,18-23H2,1-7H3/b16-14-,17-10+,25-12+ |
| InChIKey | QBXYFTWHSFLONE-DLWCREDISA-N |
| XLogP | 4.62 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|