C23H34N2O — CID 22194377
2-[1-adamantyl(methyl)amino]-N-(2,6-diethylphenyl)acetamide (PubChem CID 22194377) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 2-[1-adamantyl(methyl)amino]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[1-adamantyl(methyl)amino]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 22194377 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 2-[1-adamantyl(methyl)amino]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34N2O/c1-4-19-7-6-8-20(5-2)22(19)24-21(26)15-25(3)23-12-16-9-17(13-23)11-18(10-16)14-23/h6-8,16-18H,4-5,9-15H2,1-3H3,(H,24,26) |
| InChIKey | UPSRGBCAEAIKHB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |