C20H24ClN3O2 — CID 22195037
N-(4-chlorophenyl)-2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 22195037) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22195037 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1cccc(CN2CCN(CC(=O)Nc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-26-19-4-2-3-16(13-19)14-23-9-11-24(12-10-23)15-20(25)22-18-7-5-17(21)6-8-18/h2-8,13H,9-12,14-15H2,1H3,(H,22,25) |
| InChIKey | QMOMQTWYYJPPFJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |