C18H19ClN2O3 — CID 22199888
N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,3-dihydroindol-1-yl)acetamide (PubChem CID 22199888) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 22199888 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-(2,3-dihydroindol-1-yl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCc3ccccc32)c(OC)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O3/c1-23-16-10-14(17(24-2)9-13(16)19)20-18(22)11-21-8-7-12-5-3-4-6-15(12)21/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,22) |
| InChIKey | YLMFYCZAMBHLLZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |