C22H32N2O2S — CID 22202123
1-(2-adamantyl)-4-(4-ethylphenyl)sulfonylpiperazine (PubChem CID 22202123) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-(4-ethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-adamantyl)-4-(4-ethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22202123 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-(2-adamantyl)-4-(4-ethylphenyl)sulfonylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(C3C4CC5CC(C4)CC3C5)CC2)cc1 |
| InChI | InChI=1S/C22H32N2O2S/c1-2-16-3-5-21(6-4-16)27(25,26)24-9-7-23(8-10-24)22-19-12-17-11-18(14-19)15-20(22)13-17/h3-6,17-20,22H,2,7-15H2,1H3 |
| InChIKey | XZNJDOZZFMIEMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |