C22H30N3O2S+ — CID 2220322
dimethyl-[3-[[2-[(2-methylbenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]propyl]azanium (PubChem CID 2220322) has the molecular formula C22H30N3O2S+ and a molecular weight of 400.57 g/mol. Its IUPAC name is dimethyl-[3-[[2-[(2-methylbenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[2-[(2-methylbenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 2220322 |
| Molecular Formula | C22H30N3O2S+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | dimethyl-[3-[[2-[(2-methylbenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]propyl]azanium |
| SMILES | Cc1ccccc1C(=O)Nc1sc2c(c1C(=O)NCCC[NH+](C)C)CCCC2 |
| InChI | InChI=1S/C22H29N3O2S/c1-15-9-4-5-10-16(15)20(26)24-22-19(17-11-6-7-12-18(17)28-22)21(27)23-13-8-14-25(2)3/h4-5,9-10H,6-8,11-14H2,1-3H3,(H,23,27)(H,24,26)/p+1 |
| InChIKey | BEGTYJTZHMUBRM-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|