C21H24N2O5S — CID 18883685
[2-[[3-(2-methoxyethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl] acetate (PubChem CID 18883685) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-[[3-(2-methoxyethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[[3-(2-methoxyethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 18883685 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[[3-(2-methoxyethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]phenyl] acetate |
| SMILES | COCCNC(=O)c1c(NC(=O)c2ccccc2OC(C)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C21H24N2O5S/c1-13(24)28-16-9-5-3-7-14(16)19(25)23-21-18(20(26)22-11-12-27-2)15-8-4-6-10-17(15)29-21/h3,5,7,9H,4,6,8,10-12H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | IXFADBLMNGDJED-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|