C20H23BrN2O3S2 — CID 24519755
2-[[2-(2-bromophenyl)sulfanylacetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 24519755) has the molecular formula C20H23BrN2O3S2 and a molecular weight of 483.45 g/mol. Its IUPAC name is 2-[[2-(2-bromophenyl)sulfanylacetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-(2-bromophenyl)sulfanylacetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 24519755 |
| Molecular Formula | C20H23BrN2O3S2 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-[[2-(2-bromophenyl)sulfanylacetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNC(=O)c1c(NC(=O)CSc2ccccc2Br)sc2c1CCCC2 |
| InChI | InChI=1S/C20H23BrN2O3S2/c1-26-11-10-22-19(25)18-13-6-2-4-8-15(13)28-20(18)23-17(24)12-27-16-9-5-3-7-14(16)21/h3,5,7,9H,2,4,6,8,10-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | VMNVNKZBTJMUOW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|