C21H33N3O3S — CID 8540720
2-[[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 8540720) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 8540720 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNC(=O)c1c(NC(=O)CN2C[C@@H](C)C[C@H](C)C2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H33N3O3S/c1-14-10-15(2)12-24(11-14)13-18(25)23-21-19(20(26)22-8-9-27-3)16-6-4-5-7-17(16)28-21/h14-15H,4-13H2,1-3H3,(H,22,26)(H,23,25)/t14-,15-/m0/s1 |
| InChIKey | LUHRUVYZCNWVKZ-GJZGRUSLSA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|