C21H34N3O3S+ — CID 8540726
2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 8540726) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 8540726 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-ium-1-yl]acetyl]amino]-N-(2-methoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNC(=O)c1c(NC(=O)C[NH+]2C[C@H](C)C[C@@H](C)C2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H33N3O3S/c1-14-10-15(2)12-24(11-14)13-18(25)23-21-19(20(26)22-8-9-27-3)16-6-4-5-7-17(16)28-21/h14-15H,4-13H2,1-3H3,(H,22,26)(H,23,25)/p+1/t14-,15-/m1/s1 |
| InChIKey | LUHRUVYZCNWVKZ-HUUCEWRRSA-O |
| XLogP | 1.50 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|