C16H17N2O+ — CID 2220327
[(2S)-1-(9H-fluoren-2-ylamino)-1-oxopropan-2-yl]azanium (PubChem CID 2220327) has the molecular formula C16H17N2O+ and a molecular weight of 253.33 g/mol. Its IUPAC name is [(2S)-1-(9H-fluoren-2-ylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(2S)-1-(9H-fluoren-2-ylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 2220327 |
| Molecular Formula | C16H17N2O+ |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(2S)-1-(9H-fluoren-2-ylamino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@H]([NH3+])C(=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H16N2O/c1-10(17)16(19)18-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9-10H,8,17H2,1H3,(H,18,19)/p+1/t10-/m0/s1 |
| InChIKey | CITBTXVQVHJQMK-JTQLQIEISA-O |
| XLogP | 1.83 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |