C25H22F2N2O2 — CID 24637004
N-[1-(9H-fluoren-2-ylamino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 24637004) has the molecular formula C25H22F2N2O2 and a molecular weight of 420.46 g/mol. Its IUPAC name is N-[1-(9H-fluoren-2-ylamino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-(9H-fluoren-2-ylamino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 24637004 |
| Molecular Formula | C25H22F2N2O2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[1-(9H-fluoren-2-ylamino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1c(F)cccc1F)C(=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C25H22F2N2O2/c1-14(2)23(29-24(30)22-20(26)8-5-9-21(22)27)25(31)28-17-10-11-19-16(13-17)12-15-6-3-4-7-18(15)19/h3-11,13-14,23H,12H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | IGXNSVKRZJBSAA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |