C22H26F2N2O2 — CID 24537925
N-[(2S)-1-(4-butylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 24537925) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[(2S)-1-(4-butylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[(2S)-1-(4-butylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 24537925 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[(2S)-1-(4-butylanilino)-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | CCCCc1ccc(NC(=O)[C@@H](NC(=O)c2c(F)cccc2F)C(C)C)cc1 |
| InChI | InChI=1S/C22H26F2N2O2/c1-4-5-7-15-10-12-16(13-11-15)25-22(28)20(14(2)3)26-21(27)19-17(23)8-6-9-18(19)24/h6,8-14,20H,4-5,7H2,1-3H3,(H,25,28)(H,26,27)/t20-/m0/s1 |
| InChIKey | DNZISFTXTCPPDZ-FQEVSTJZSA-N |
| XLogP | 4.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |